|
Detalhes do produto:
|
| Nome do produto: | Sal de potássio da penicilina G | CAS: | 113-98-4 |
|---|---|---|---|
| Forma: | pó | cor: | Agulhas de butanol (aq) |
| Temperatura de armazenamento.: | Selado em seco, guarde no freezer, com menos de -20 ° C | EINECS: | 204-038-0 |
| Ponto de fusão: | 214-217 c | ||
| Destacar: | Penicillin G potassium salt biological reagents,Penicillin G potassium salt CAS 113-98-4,Penicillin G potassium salt industrial chemicals |
||
CAS 113-98-4 Penicillin G potassium salt
| Penicillin G potassium salt Basic information |
| Product Name: | Penicillin G potassium salt |
| Synonyms: | tabilin;PENICILLIN G K-SALT;PENICILLIN G POTASSIUM SALT;PENICILLIN G POTASSIUM;potassium [2s-(2alpha,5alpha,6beta)]-3,3-dimethyl-7-oxo-6-(phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;potassium benzylpenicillin;4-Thia-1-azabicyclo;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-, [2S-(2alpha,5alpha,6beta)]-, monopotassium salt |
| CAS: | 113-98-4 |
| MF: | C16H17KN2O4S |
| MW: | 372.48 |
| EINECS: | 204-038-0 |
| Product Categories: | Heterocycles;Intermediates & Fine Chemicals;Antibiotics for Research and Experimental Use;API's;Pharmaceuticals;Sulfur & Selenium Compounds;beta-Lactams (Antibiotics for Research and Experimental Use);Biochemistry;113-98-4 |
| Mol File: | 113-98-4.mol |
| Penicillin G potassium salt Chemical Properties |
| Melting point | 214-217 C |
| alpha | D22 +285° (c = 0.748 in water) |
| refractive index | 294 ° (C=1, H2O) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | Needles from butanol (aq) |
| PH | pH (10g/L, 25℃) : 5.0~7.5 |
| Water Solubility | Soluble in water (100 mg/ml), methanol, ethanol (sparingly), and alcohol. Insoluble in chloroform. |
| BRN | 3832841 |
| Stability: | Hygroscopic |
| InChIKey | IYNDLOXRXUOGIU-LQDWTQKMSA-M |
| SMILES | N12C([C@@H](NC(=O)CC3=CC=CC=C3)[C@@]1([H])SC(C)(C)[C@@H]2C([O-])=O)=O.[K+] |&1:2,13,19,r| |
| EPA Substance Registry System | Penicillin G Potassium (113-98-4) |
| Safety Information |
| Hazard Codes | Xn,C,F |
| Risk Statements | 42/43-34-11 |
| Safety Statements | 36/37-45-36/37/39-26-16-60-37-24-22 |
| WGK Germany | 2 |
| RTECS | XH9700000 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29411000 |
| Toxicity | LD50 oral in rabbit: 5848mg/kg |
![]()
Pessoa de Contato: Maggie Ma
Telefone: +0086 188 7414 9531