|
Detalhes do produto:
|
| Nome do produto: | 4-Cloro-7-nitrobenzofurazan | CAS: | 10199-89-0 |
|---|---|---|---|
| EINECS: | 233-496-4 | Ponto de fusão: | 97-99 °C (iluminado.) |
| Temperatura de armazenamento.: | Atmosfera inerte, temperatura ambiente | Forma: | pó cristalino |
| cor: | Amarelo a marrom claro | ||
| Destacar: | 4-Chloro-7-nitrobenzofurazan biochemical reagent,CAS 10199-89-0 lab reagent,4-Chloro-7-nitrobenzofurazan industrial fine chemical |
||
CAS 10199-89-0 4-Chloro-7-nitrobenzofurazan biochemical reagent for labs
| Product Name: | 4-Chloro-7-nitrobenzofurazan |
| Synonyms: | 4-CHLORO-7-NITROBENZOFURAZAN, FOR FLUORE SCENCE;7-CHLORO-4-NITROBENZ-2-OXA-1-3-DIAZOLECR YSTALLINE;4-Chloro-7-nitrobenzo-2,1,3-oxadiazole~NBDchloride;2,1,3-Benzoxadiazole, 4-chloro-7-nitro-;4-chloro-7-nitrobenzo-2,1,3-oxadiazole;NBD-Cl (=4-Chloro-7-nitro-2,1,3-benzoxadiazole) [for HPLC Labeling];4-chloro-7-nitrobenzofurazane;4-Chloro-7-nitro-1,2,3-benzoxadiazole, NBD-chloride |
| CAS: | 10199-89-0 |
| MF: | C6H2ClN3O3 |
| MW: | 199.55 |
| EINECS: | 233-496-4 |
| Product Categories: | Functional Group Reactive Labels for Immunoassays;Biochemicals and Reagents;Miscellaneous;Amino Group Labeling Reagents for Fluorescence HPLC;Analytical Chemistry;Fluorescence Detection (HPLC Labeling Reagents);HPLC Labeling Reagents;Mercapto Group Labeling Reagents for Fluorescence HPLC;Pharmaceutical intermediate;Aromatics;Fluorescent Labels & Indicators;Heterocycles;Building Blocks;Chemical Synthesis;Derivatization agents;Fluorescent Probes;Functional Group Reactive Labels;Halogenated Heterocycles;Heterocyclic Building Blocks;Labels;Luminescent Compounds/Detection;Oxadiazoles;Particles and Stains |
| Mol File: | 10199-89-0.mol |
| 4-Chloro-7-nitrobenzofurazan Chemical Properties |
| Melting point | 97-99 °C(lit.) |
| Boiling point | 333.1±45.0 °C(Predicted) |
| density | 2.0589 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol, dimethylsulfoxide, dimethylformamide and chloroform. |
| form | Crystalline Powder |
| pka | -5.65±0.50(Predicted) |
| color | Yellow to light brown |
| Water Solubility | soluble |
| BRN | 614212 |
| InChI | InChI=1S/C6H2ClN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H |
| InChIKey | IGHBXJSNZCFXNK-UHFFFAOYSA-N |
| SMILES | N1=C2C([N+]([O-])=O)=CC=C(Cl)C2=NO1 |
| CAS DataBase Reference | 10199-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,1,3-Benzoxadiazole, 4-chloro-7-nitro- (10199-89-0) |
![]()
Pessoa de Contato: Maggie Ma
Telefone: +0086 188 7414 9531